About potassium;hydride;1,1,1-trifluoropropan-2-ylsulfamic acid
potassium;hydride;1,1,1-trifluoropropan-2-ylsulfamic acid (PubChem CID 173392627) has the molecular formula C3H7F3KNO3S
and a molecular weight of 233.25 g/mol. Its IUPAC name is potassium;hydride;1,1,1-trifluoropropan-2-ylsulfamic acid.
Molecular Properties
| Compound Name | potassium;hydride;1,1,1-trifluoropropan-2-ylsulfamic acid |
| PubChem CID | 173392627 |
| Molecular Formula | C3H7F3KNO3S |
| Molecular Weight | 233.25 g/mol |
| Exact Mass | 232.97 |
| IUPAC Name | potassium;hydride;1,1,1-trifluoropropan-2-ylsulfamic acid |
| SMILES | CC(NS(=O)(=O)O)C(F)(F)F.[H-].[K+] |
| InChI | InChI=1S/C3H6F3NO3S.K.H/c1-2(3(4,5)6)7-11(8,9)10;;/h2,7H,1H3,(H,8,9,10);;/q;+1;-1 |
| InChIKey | QDQTXYSCUBQPMF-UHFFFAOYSA-N |
| XLogP | -2.55 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 233.25 |
| LogP ≤ 5 | -2.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|
Analyze potassium;hydride;1,1,1-trifluoropropan-2-ylsulfamic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of potassium;hydride;1,1,1-trifluoropropan-2-ylsulfamic acid?
The IUPAC name of potassium;hydride;1,1,1-trifluoropropan-2-ylsulfamic acid (CID 173392627) is potassium;hydride;1,1,1-trifluoropropan-2-ylsulfamic acid.
What is the SMILES notation for potassium;hydride;1,1,1-trifluoropropan-2-ylsulfamic acid?
The canonical SMILES for potassium;hydride;1,1,1-trifluoropropan-2-ylsulfamic acid is CC(NS(=O)(=O)O)C(F)(F)F.[H-].[K+].
What is the InChIKey of potassium;hydride;1,1,1-trifluoropropan-2-ylsulfamic acid?
The InChIKey is QDQTXYSCUBQPMF-UHFFFAOYSA-N. The full InChI is InChI=1S/C3H6F3NO3S.K.H/c1-2(3(4,5)6)7-11(8,9)10;;/h2,7H,1H3,(H,8,9,10);;/q;+1;-1.
What are the key properties of potassium;hydride;1,1,1-trifluoropropan-2-ylsulfamic acid?
potassium;hydride;1,1,1-trifluoropropan-2-ylsulfamic acid has a molecular weight of 233.25 g/mol, XLogP of -2.55, 2 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for potassium;hydride;1,1,1-trifluoropropan-2-ylsulfamic acid is sourced from PubChem (CID 173392627), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).