About but-1-enyl-hydroxy-oxophosphanium;isocyanic acid
but-1-enyl-hydroxy-oxophosphanium;isocyanic acid (PubChem CID 173393186) has the molecular formula C5H9NO3P+
and a molecular weight of 162.11 g/mol. Its IUPAC name is but-1-enyl-hydroxy-oxophosphanium;isocyanic acid.
Molecular Properties
| Compound Name | but-1-enyl-hydroxy-oxophosphanium;isocyanic acid |
| PubChem CID | 173393186 |
| Molecular Formula | C5H9NO3P+ |
| Molecular Weight | 162.11 g/mol |
| Exact Mass | 162.03 |
| IUPAC Name | but-1-enyl-hydroxy-oxophosphanium;isocyanic acid |
| SMILES | CCC=C[P+](=O)O.N=C=O |
| InChI | InChI=1S/C4H7O2P.CHNO/c1-2-3-4-7(5)6;2-1-3/h3-4H,2H2,1H3;2H/p+1 |
| InChIKey | COHFUZSSFSZTCB-UHFFFAOYSA-O |
| XLogP | 1.55 |
| TPSA | 78.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 162.11 |
| LogP ≤ 5 | 1.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isocyanate', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze but-1-enyl-hydroxy-oxophosphanium;isocyanic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of but-1-enyl-hydroxy-oxophosphanium;isocyanic acid?
The IUPAC name of but-1-enyl-hydroxy-oxophosphanium;isocyanic acid (CID 173393186) is but-1-enyl-hydroxy-oxophosphanium;isocyanic acid.
What is the SMILES notation for but-1-enyl-hydroxy-oxophosphanium;isocyanic acid?
The canonical SMILES for but-1-enyl-hydroxy-oxophosphanium;isocyanic acid is CCC=C[P+](=O)O.N=C=O.
What is the InChIKey of but-1-enyl-hydroxy-oxophosphanium;isocyanic acid?
The InChIKey is COHFUZSSFSZTCB-UHFFFAOYSA-O. The full InChI is InChI=1S/C4H7O2P.CHNO/c1-2-3-4-7(5)6;2-1-3/h3-4H,2H2,1H3;2H/p+1.
What are the key properties of but-1-enyl-hydroxy-oxophosphanium;isocyanic acid?
but-1-enyl-hydroxy-oxophosphanium;isocyanic acid has a molecular weight of 162.11 g/mol, XLogP of 1.55, 2 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for but-1-enyl-hydroxy-oxophosphanium;isocyanic acid is sourced from PubChem (CID 173393186), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).