C25H32O4S — CID 173393699
1-(4-decylsulfanylphenyl)-3-(2,3,6-trihydroxyphenyl)prop-2-en-1-one (PubChem CID 173393699) has the molecular formula C25H32O4S and a molecular weight of 428.59 g/mol. Its IUPAC name is 1-(4-decylsulfanylphenyl)-3-(2,3,6-trihydroxyphenyl)prop-2-en-1-one.
| Compound Name | 1-(4-decylsulfanylphenyl)-3-(2,3,6-trihydroxyphenyl)prop-2-en-1-one |
|---|---|
| PubChem CID | 173393699 |
| Molecular Formula | C25H32O4S |
| Molecular Weight | 428.59 g/mol |
| Exact Mass | 428.20 |
| IUPAC Name | 1-(4-decylsulfanylphenyl)-3-(2,3,6-trihydroxyphenyl)prop-2-en-1-one |
| SMILES | CCCCCCCCCCSc1ccc(C(=O)C=Cc2c(O)ccc(O)c2O)cc1 |
| InChI | InChI=1S/C25H32O4S/c1-2-3-4-5-6-7-8-9-18-30-20-12-10-19(11-13-20)22(26)15-14-21-23(27)16-17-24(28)25(21)29/h10-17,27-29H,2-9,18H2,1H3 |
| InChIKey | KBTIBPUVAYRKGH-UHFFFAOYSA-N |
| XLogP | 6.93 |
| TPSA | 77.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.59 |
| LogP ≤ 5 | 6.93 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|