About potassium;3-bromoacridine;hydride
potassium;3-bromoacridine;hydride (PubChem CID 173393779) has the molecular formula C13H9BrKN
and a molecular weight of 298.22 g/mol. Its IUPAC name is potassium;3-bromoacridine;hydride.
Molecular Properties
| Compound Name | potassium;3-bromoacridine;hydride |
| PubChem CID | 173393779 |
| Molecular Formula | C13H9BrKN |
| Molecular Weight | 298.22 g/mol |
| Exact Mass | 296.96 |
| IUPAC Name | potassium;3-bromoacridine;hydride |
| SMILES | Brc1ccc2cc3ccccc3nc2c1.[H-].[K+] |
| InChI | InChI=1S/C13H8BrN.K.H/c14-11-6-5-10-7-9-3-1-2-4-12(9)15-13(10)8-11;;/h1-8H;;/q;+1;-1 |
| InChIKey | NPUYHBDKWMRFHB-UHFFFAOYSA-N |
| XLogP | 1.27 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 298.22 |
| LogP ≤ 5 | 1.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|
Analyze potassium;3-bromoacridine;hydride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of potassium;3-bromoacridine;hydride?
The IUPAC name of potassium;3-bromoacridine;hydride (CID 173393779) is potassium;3-bromoacridine;hydride.
What is the SMILES notation for potassium;3-bromoacridine;hydride?
The canonical SMILES for potassium;3-bromoacridine;hydride is Brc1ccc2cc3ccccc3nc2c1.[H-].[K+].
What is the InChIKey of potassium;3-bromoacridine;hydride?
The InChIKey is NPUYHBDKWMRFHB-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H8BrN.K.H/c14-11-6-5-10-7-9-3-1-2-4-12(9)15-13(10)8-11;;/h1-8H;;/q;+1;-1.
What are the key properties of potassium;3-bromoacridine;hydride?
potassium;3-bromoacridine;hydride has a molecular weight of 298.22 g/mol, XLogP of 1.27, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for potassium;3-bromoacridine;hydride is sourced from PubChem (CID 173393779), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).