C10H16N8OS2 — CID 173393996
2-[4-[4-[(4-amino-1-oxido-1,2,5-thiadiazol-1-ium-3-ylidene)amino]butyl]-1,3-thiazol-2-yl]guanidine (PubChem CID 173393996) has the molecular formula C10H16N8OS2 and a molecular weight of 328.43 g/mol. Its IUPAC name is 2-[4-[4-[(4-amino-1-oxido-1,2,5-thiadiazol-1-ium-3-ylidene)amino]butyl]-1,3-thiazol-2-yl]guanidine.
| Compound Name | 2-[4-[4-[(4-amino-1-oxido-1,2,5-thiadiazol-1-ium-3-ylidene)amino]butyl]-1,3-thiazol-2-yl]guanidine |
|---|---|
| PubChem CID | 173393996 |
| Molecular Formula | C10H16N8OS2 |
| Molecular Weight | 328.43 g/mol |
| Exact Mass | 328.09 |
| IUPAC Name | 2-[4-[4-[(4-amino-1-oxido-1,2,5-thiadiazol-1-ium-3-ylidene)amino]butyl]-1,3-thiazol-2-yl]guanidine |
| SMILES | NC(N)=Nc1nc(CCCC/N=c2\[nH][s+]([O-])nc2N)cs1 |
| InChI | InChI=1S/C10H16N8OS2/c11-7-8(18-21(19)17-7)14-4-2-1-3-6-5-20-10(15-6)16-9(12)13/h5H,1-4H2,(H2,11,17)(H,14,18)(H4,12,13,15,16) |
| InChIKey | JTIJPISCQVLDLV-UHFFFAOYSA-N |
| XLogP | 0.00 |
| TPSA | 167.41 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.43 |
| LogP ≤ 5 | 0.00 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|