About (2,5-dioxopyrrolidin-1-yl) 4-ethylhexa-2,4-dienoate
(2,5-dioxopyrrolidin-1-yl) 4-ethylhexa-2,4-dienoate (PubChem CID 173394070) has the molecular formula C12H15NO4
and a molecular weight of 237.25 g/mol. Its IUPAC name is (2,5-dioxopyrrolidin-1-yl) 4-ethylhexa-2,4-dienoate.
Molecular Properties
| Compound Name | (2,5-dioxopyrrolidin-1-yl) 4-ethylhexa-2,4-dienoate |
| PubChem CID | 173394070 |
| Molecular Formula | C12H15NO4 |
| Molecular Weight | 237.25 g/mol |
| Exact Mass | 237.10 |
| IUPAC Name | (2,5-dioxopyrrolidin-1-yl) 4-ethylhexa-2,4-dienoate |
| SMILES | CC=C(C=CC(=O)ON1C(=O)CCC1=O)CC |
| InChI | InChI=1S/C12H15NO4/c1-3-9(4-2)5-8-12(16)17-13-10(14)6-7-11(13)15/h3,5,8H,4,6-7H2,1-2H3 |
| InChIKey | LHYYFQMKKWXQFI-UHFFFAOYSA-N |
| XLogP | 1.51 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 237.25 |
| LogP ≤ 5 | 1.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze (2,5-dioxopyrrolidin-1-yl) 4-ethylhexa-2,4-dienoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2,5-dioxopyrrolidin-1-yl) 4-ethylhexa-2,4-dienoate?
The IUPAC name of (2,5-dioxopyrrolidin-1-yl) 4-ethylhexa-2,4-dienoate (CID 173394070) is (2,5-dioxopyrrolidin-1-yl) 4-ethylhexa-2,4-dienoate.
What is the SMILES notation for (2,5-dioxopyrrolidin-1-yl) 4-ethylhexa-2,4-dienoate?
The canonical SMILES for (2,5-dioxopyrrolidin-1-yl) 4-ethylhexa-2,4-dienoate is CC=C(C=CC(=O)ON1C(=O)CCC1=O)CC.
What is the InChIKey of (2,5-dioxopyrrolidin-1-yl) 4-ethylhexa-2,4-dienoate?
The InChIKey is LHYYFQMKKWXQFI-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H15NO4/c1-3-9(4-2)5-8-12(16)17-13-10(14)6-7-11(13)15/h3,5,8H,4,6-7H2,1-2H3.
What are the key properties of (2,5-dioxopyrrolidin-1-yl) 4-ethylhexa-2,4-dienoate?
(2,5-dioxopyrrolidin-1-yl) 4-ethylhexa-2,4-dienoate has a molecular weight of 237.25 g/mol, XLogP of 1.51, 4 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (2,5-dioxopyrrolidin-1-yl) 4-ethylhexa-2,4-dienoate is sourced from PubChem (CID 173394070), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).