About carboxymethyl(trimethyl)azanium;[4-(sulfinomethyl)pyrrolidin-3-yl]methanesulfonate
carboxymethyl(trimethyl)azanium;[4-(sulfinomethyl)pyrrolidin-3-yl]methanesulfonate (PubChem CID 173394162) has the molecular formula C11H24N2O7S2
and a molecular weight of 360.45 g/mol. Its IUPAC name is carboxymethyl(trimethyl)azanium;[4-(sulfinomethyl)pyrrolidin-3-yl]methanesulfonate.
Molecular Properties
| Compound Name | carboxymethyl(trimethyl)azanium;[4-(sulfinomethyl)pyrrolidin-3-yl]methanesulfonate |
| PubChem CID | 173394162 |
| Molecular Formula | C11H24N2O7S2 |
| Molecular Weight | 360.45 g/mol |
| Exact Mass | 360.10 |
| IUPAC Name | carboxymethyl(trimethyl)azanium;[4-(sulfinomethyl)pyrrolidin-3-yl]methanesulfonate |
| SMILES | C[N+](C)(C)CC(=O)O.O=S(O)CC1CNCC1CS(=O)(=O)[O-] |
| InChI | InChI=1S/C6H13NO5S2.C5H11NO2/c8-13(9)3-5-1-7-2-6(5)4-14(10,11)12;1-6(2,3)4-5(7)8/h5-7H,1-4H2,(H,8,9)(H,10,11,12);4H2,1-3H3 |
| InChIKey | RKPJANRQMVGRPU-UHFFFAOYSA-N |
| XLogP | -1.63 |
| TPSA | 143.83 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 360.45 |
| LogP ≤ 5 | -1.63 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'}, {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|
Analyze carboxymethyl(trimethyl)azanium;[4-(sulfinomethyl)pyrrolidin-3-yl]methanesulfonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of carboxymethyl(trimethyl)azanium;[4-(sulfinomethyl)pyrrolidin-3-yl]methanesulfonate?
The IUPAC name of carboxymethyl(trimethyl)azanium;[4-(sulfinomethyl)pyrrolidin-3-yl]methanesulfonate (CID 173394162) is carboxymethyl(trimethyl)azanium;[4-(sulfinomethyl)pyrrolidin-3-yl]methanesulfonate.
What is the SMILES notation for carboxymethyl(trimethyl)azanium;[4-(sulfinomethyl)pyrrolidin-3-yl]methanesulfonate?
The canonical SMILES for carboxymethyl(trimethyl)azanium;[4-(sulfinomethyl)pyrrolidin-3-yl]methanesulfonate is C[N+](C)(C)CC(=O)O.O=S(O)CC1CNCC1CS(=O)(=O)[O-].
What is the InChIKey of carboxymethyl(trimethyl)azanium;[4-(sulfinomethyl)pyrrolidin-3-yl]methanesulfonate?
The InChIKey is RKPJANRQMVGRPU-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H13NO5S2.C5H11NO2/c8-13(9)3-5-1-7-2-6(5)4-14(10,11)12;1-6(2,3)4-5(7)8/h5-7H,1-4H2,(H,8,9)(H,10,11,12);4H2,1-3H3.
What are the key properties of carboxymethyl(trimethyl)azanium;[4-(sulfinomethyl)pyrrolidin-3-yl]methanesulfonate?
carboxymethyl(trimethyl)azanium;[4-(sulfinomethyl)pyrrolidin-3-yl]methanesulfonate has a molecular weight of 360.45 g/mol, XLogP of -1.63, 6 rotatable bonds, 3 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for carboxymethyl(trimethyl)azanium;[4-(sulfinomethyl)pyrrolidin-3-yl]methanesulfonate is sourced from PubChem (CID 173394162), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).