C9H13F7OSi — CID 173394999
[4-(1,2,2,3,3,4,4-heptafluorocyclobutyl)-2-methylbutan-2-yl]oxysilane (PubChem CID 173394999) has the molecular formula C9H13F7OSi and a molecular weight of 298.27 g/mol. Its IUPAC name is [4-(1,2,2,3,3,4,4-heptafluorocyclobutyl)-2-methylbutan-2-yl]oxysilane.
| Compound Name | [4-(1,2,2,3,3,4,4-heptafluorocyclobutyl)-2-methylbutan-2-yl]oxysilane |
|---|---|
| PubChem CID | 173394999 |
| Molecular Formula | C9H13F7OSi |
| Molecular Weight | 298.27 g/mol |
| Exact Mass | 298.06 |
| IUPAC Name | [4-(1,2,2,3,3,4,4-heptafluorocyclobutyl)-2-methylbutan-2-yl]oxysilane |
| SMILES | CC(C)(CCC1(F)C(F)(F)C(F)(F)C1(F)F)O[SiH3] |
| InChI | InChI=1S/C9H13F7OSi/c1-5(2,17-18)3-4-6(10)7(11,12)9(15,16)8(6,13)14/h3-4H2,1-2,18H3 |
| InChIKey | ASNRFZBBHAFTJB-UHFFFAOYSA-N |
| XLogP | 2.47 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.27 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|