C19H38O5Si — CID 173396993
1-(2,2-dimethyl-1,3-dioxolan-4-yl)-1-dimethylsilyloxy-2-hydroxy-9,9-dimethyldecan-4-one (PubChem CID 173396993) has the molecular formula C19H38O5Si and a molecular weight of 374.59 g/mol. Its IUPAC name is 1-(2,2-dimethyl-1,3-dioxolan-4-yl)-1-dimethylsilyloxy-2-hydroxy-9,9-dimethyldecan-4-one.
| Compound Name | 1-(2,2-dimethyl-1,3-dioxolan-4-yl)-1-dimethylsilyloxy-2-hydroxy-9,9-dimethyldecan-4-one |
|---|---|
| PubChem CID | 173396993 |
| Molecular Formula | C19H38O5Si |
| Molecular Weight | 374.59 g/mol |
| Exact Mass | 374.25 |
| IUPAC Name | 1-(2,2-dimethyl-1,3-dioxolan-4-yl)-1-dimethylsilyloxy-2-hydroxy-9,9-dimethyldecan-4-one |
| SMILES | C[SiH](C)OC(C(O)CC(=O)CCCCC(C)(C)C)C1COC(C)(C)O1 |
| InChI | InChI=1S/C19H38O5Si/c1-18(2,3)11-9-8-10-14(20)12-15(21)17(24-25(6)7)16-13-22-19(4,5)23-16/h15-17,21,25H,8-13H2,1-7H3 |
| InChIKey | VYDLVMYLJVLCFD-UHFFFAOYSA-N |
| XLogP | 3.43 |
| TPSA | 64.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.59 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|