C24H40N6 — CID 173396996
(1Z,9E)-2,3,8,9,11,17-hexamethyl-3,8,12,16,19,23-hexazabicyclo[8.7.7]tetracosa-1,9,11,16,18,23-hexaene (PubChem CID 173396996) has the molecular formula C24H40N6 and a molecular weight of 412.63 g/mol. Its IUPAC name is (1Z,9E)-2,3,8,9,11,17-hexamethyl-3,8,12,16,19,23-hexazabicyclo[8.7.7]tetracosa-1,9,11,16,18,23-hexaene.
| Compound Name | (1Z,9E)-2,3,8,9,11,17-hexamethyl-3,8,12,16,19,23-hexazabicyclo[8.7.7]tetracosa-1,9,11,16,18,23-hexaene |
|---|---|
| PubChem CID | 173396996 |
| Molecular Formula | C24H40N6 |
| Molecular Weight | 412.63 g/mol |
| Exact Mass | 412.33 |
| IUPAC Name | (1Z,9E)-2,3,8,9,11,17-hexamethyl-3,8,12,16,19,23-hexazabicyclo[8.7.7]tetracosa-1,9,11,16,18,23-hexaene |
| SMILES | C/C1=N/CCC/N=C(C)/C2=C(/C)N(C)CCCCN(C)/C(C)=C1/C=N\CCC\N=C\2 |
| InChI | InChI=1S/C24H40N6/c1-19-23-17-25-11-9-12-26-18-24(20(2)28-14-10-13-27-19)22(4)30(6)16-8-7-15-29(5)21(23)3/h17-18H,7-16H2,1-6H3/b23-21-,24-22-,25-17-,26-18+,27-19-,28-20+ |
| InChIKey | PBGRSBKPXKFINB-WWQKVVGKSA-N |
| XLogP | 4.05 |
| TPSA | 55.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.63 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |