About butan-2-yl 2-bromo-3-(3-formyloxy-2,2-dimethylcyclopropyl)prop-2-enoate
butan-2-yl 2-bromo-3-(3-formyloxy-2,2-dimethylcyclopropyl)prop-2-enoate (PubChem CID 173397031) has the molecular formula C13H19BrO4
and a molecular weight of 319.20 g/mol. Its IUPAC name is butan-2-yl 2-bromo-3-(3-formyloxy-2,2-dimethylcyclopropyl)prop-2-enoate.
Molecular Properties
| Compound Name | butan-2-yl 2-bromo-3-(3-formyloxy-2,2-dimethylcyclopropyl)prop-2-enoate |
| PubChem CID | 173397031 |
| Molecular Formula | C13H19BrO4 |
| Molecular Weight | 319.20 g/mol |
| Exact Mass | 318.05 |
| IUPAC Name | butan-2-yl 2-bromo-3-(3-formyloxy-2,2-dimethylcyclopropyl)prop-2-enoate |
| SMILES | CCC(C)OC(=O)C(Br)=CC1C(OC=O)C1(C)C |
| InChI | InChI=1S/C13H19BrO4/c1-5-8(2)18-12(16)10(14)6-9-11(17-7-15)13(9,3)4/h6-9,11H,5H2,1-4H3 |
| InChIKey | AHCSWCOGWJUQOB-UHFFFAOYSA-N |
| XLogP | 2.80 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 319.20 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze butan-2-yl 2-bromo-3-(3-formyloxy-2,2-dimethylcyclopropyl)prop-2-enoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of butan-2-yl 2-bromo-3-(3-formyloxy-2,2-dimethylcyclopropyl)prop-2-enoate?
The IUPAC name of butan-2-yl 2-bromo-3-(3-formyloxy-2,2-dimethylcyclopropyl)prop-2-enoate (CID 173397031) is butan-2-yl 2-bromo-3-(3-formyloxy-2,2-dimethylcyclopropyl)prop-2-enoate.
What is the SMILES notation for butan-2-yl 2-bromo-3-(3-formyloxy-2,2-dimethylcyclopropyl)prop-2-enoate?
The canonical SMILES for butan-2-yl 2-bromo-3-(3-formyloxy-2,2-dimethylcyclopropyl)prop-2-enoate is CCC(C)OC(=O)C(Br)=CC1C(OC=O)C1(C)C.
What is the InChIKey of butan-2-yl 2-bromo-3-(3-formyloxy-2,2-dimethylcyclopropyl)prop-2-enoate?
The InChIKey is AHCSWCOGWJUQOB-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H19BrO4/c1-5-8(2)18-12(16)10(14)6-9-11(17-7-15)13(9,3)4/h6-9,11H,5H2,1-4H3.
What are the key properties of butan-2-yl 2-bromo-3-(3-formyloxy-2,2-dimethylcyclopropyl)prop-2-enoate?
butan-2-yl 2-bromo-3-(3-formyloxy-2,2-dimethylcyclopropyl)prop-2-enoate has a molecular weight of 319.20 g/mol, XLogP of 2.80, 6 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for butan-2-yl 2-bromo-3-(3-formyloxy-2,2-dimethylcyclopropyl)prop-2-enoate is sourced from PubChem (CID 173397031), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).