About methyl 2-methyl-3-propylhex-2-enoate;stannane
methyl 2-methyl-3-propylhex-2-enoate;stannane (PubChem CID 173397601) has the molecular formula C11H24O2Sn
and a molecular weight of 307.02 g/mol. Its IUPAC name is methyl 2-methyl-3-propylhex-2-enoate;stannane.
Molecular Properties
| Compound Name | methyl 2-methyl-3-propylhex-2-enoate;stannane |
| PubChem CID | 173397601 |
| Molecular Formula | C11H24O2Sn |
| Molecular Weight | 307.02 g/mol |
| Exact Mass | 308.08 |
| IUPAC Name | methyl 2-methyl-3-propylhex-2-enoate;stannane |
| SMILES | CCCC(CCC)=C(C)C(=O)OC.[SnH4] |
| InChI | InChI=1S/C11H20O2.Sn.4H/c1-5-7-10(8-6-2)9(3)11(12)13-4;;;;;/h5-8H2,1-4H3;;;;; |
| InChIKey | KPRBXSLDLPWSMC-UHFFFAOYSA-N |
| XLogP | 1.62 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 307.02 |
| LogP ≤ 5 | 1.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze methyl 2-methyl-3-propylhex-2-enoate;stannane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 2-methyl-3-propylhex-2-enoate;stannane?
The IUPAC name of methyl 2-methyl-3-propylhex-2-enoate;stannane (CID 173397601) is methyl 2-methyl-3-propylhex-2-enoate;stannane.
What is the SMILES notation for methyl 2-methyl-3-propylhex-2-enoate;stannane?
The canonical SMILES for methyl 2-methyl-3-propylhex-2-enoate;stannane is CCCC(CCC)=C(C)C(=O)OC.[SnH4].
What is the InChIKey of methyl 2-methyl-3-propylhex-2-enoate;stannane?
The InChIKey is KPRBXSLDLPWSMC-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H20O2.Sn.4H/c1-5-7-10(8-6-2)9(3)11(12)13-4;;;;;/h5-8H2,1-4H3;;;;;.
What are the key properties of methyl 2-methyl-3-propylhex-2-enoate;stannane?
methyl 2-methyl-3-propylhex-2-enoate;stannane has a molecular weight of 307.02 g/mol, XLogP of 1.62, 5 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 2-methyl-3-propylhex-2-enoate;stannane is sourced from PubChem (CID 173397601), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).