C18H17Cl3O3 — CID 173397616
hexa-3,5-dien-2-one;phenol;2,3,4-trichlorophenol (PubChem CID 173397616) has the molecular formula C18H17Cl3O3 and a molecular weight of 387.69 g/mol. Its IUPAC name is hexa-3,5-dien-2-one;phenol;2,3,4-trichlorophenol.
| Compound Name | hexa-3,5-dien-2-one;phenol;2,3,4-trichlorophenol |
|---|---|
| PubChem CID | 173397616 |
| Molecular Formula | C18H17Cl3O3 |
| Molecular Weight | 387.69 g/mol |
| Exact Mass | 386.02 |
| IUPAC Name | hexa-3,5-dien-2-one;phenol;2,3,4-trichlorophenol |
| SMILES | C=CC=CC(C)=O.Oc1ccc(Cl)c(Cl)c1Cl.Oc1ccccc1 |
| InChI | InChI=1S/C6H3Cl3O.C6H6O.C6H8O/c7-3-1-2-4(10)6(9)5(3)8;7-6-4-2-1-3-5-6;1-3-4-5-6(2)7/h1-2,10H;1-5,7H;3-5H,1H2,2H3 |
| InChIKey | JKAOXCVCCVJDOT-UHFFFAOYSA-N |
| XLogP | 6.06 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.69 |
| LogP ≤ 5 | 6.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|