About hexylsilane;sulfuryl diazide
hexylsilane;sulfuryl diazide (PubChem CID 173397823) has the molecular formula C6H16N6O2SSi
and a molecular weight of 264.39 g/mol. Its IUPAC name is hexylsilane;sulfuryl diazide.
Molecular Properties
| Compound Name | hexylsilane;sulfuryl diazide |
| PubChem CID | 173397823 |
| Molecular Formula | C6H16N6O2SSi |
| Molecular Weight | 264.39 g/mol |
| Exact Mass | 264.08 |
| IUPAC Name | hexylsilane;sulfuryl diazide |
| SMILES | CCCCCC[SiH3].[N-]=[N+]=NS(=O)(=O)N=[N+]=[N-] |
| InChI | InChI=1S/C6H16Si.N6O2S/c1-2-3-4-5-6-7;1-3-5-9(7,8)6-4-2/h2-6H2,1,7H3; |
| InChIKey | MMEOCZFJXBSQAA-UHFFFAOYSA-N |
| XLogP | 2.20 |
| TPSA | 131.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 264.39 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze hexylsilane;sulfuryl diazide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of hexylsilane;sulfuryl diazide?
The IUPAC name of hexylsilane;sulfuryl diazide (CID 173397823) is hexylsilane;sulfuryl diazide.
What is the SMILES notation for hexylsilane;sulfuryl diazide?
The canonical SMILES for hexylsilane;sulfuryl diazide is CCCCCC[SiH3].[N-]=[N+]=NS(=O)(=O)N=[N+]=[N-].
What is the InChIKey of hexylsilane;sulfuryl diazide?
The InChIKey is MMEOCZFJXBSQAA-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H16Si.N6O2S/c1-2-3-4-5-6-7;1-3-5-9(7,8)6-4-2/h2-6H2,1,7H3;.
What are the key properties of hexylsilane;sulfuryl diazide?
hexylsilane;sulfuryl diazide has a molecular weight of 264.39 g/mol, XLogP of 2.20, 6 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for hexylsilane;sulfuryl diazide is sourced from PubChem (CID 173397823), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).