C6H2F4S — CID 173398000
3,4,5,6-tetrafluorocyclohexa-2,4-diene-1-thione (PubChem CID 173398000) has the molecular formula C6H2F4S and a molecular weight of 182.14 g/mol. Its IUPAC name is 3,4,5,6-tetrafluorocyclohexa-2,4-diene-1-thione.
| Compound Name | 3,4,5,6-tetrafluorocyclohexa-2,4-diene-1-thione |
|---|---|
| PubChem CID | 173398000 |
| Molecular Formula | C6H2F4S |
| Molecular Weight | 182.14 g/mol |
| Exact Mass | 181.98 |
| IUPAC Name | 3,4,5,6-tetrafluorocyclohexa-2,4-diene-1-thione |
| SMILES | FC1=CC(=S)C(F)C(F)=C1F |
| InChI | InChI=1S/C6H2F4S/c7-2-1-3(11)5(9)6(10)4(2)8/h1,5H |
| InChIKey | OTAZATYVNRGYGJ-UHFFFAOYSA-N |
| XLogP | 2.71 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 182.14 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'thio_ketone(43)', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|