About 3-(3,4-dimethylphenyl)-1-morpholin-4-yl-5-[4-(trifluoromethyl)phenyl]penta-2,4-dien-1-one
3-(3,4-dimethylphenyl)-1-morpholin-4-yl-5-[4-(trifluoromethyl)phenyl]penta-2,4-dien-1-one (PubChem CID 173398189) has the molecular formula C24H24F3NO2
and a molecular weight of 415.46 g/mol. Its IUPAC name is 3-(3,4-dimethylphenyl)-1-morpholin-4-yl-5-[4-(trifluoromethyl)phenyl]penta-2,4-dien-1-one.
Molecular Properties
| Compound Name | 3-(3,4-dimethylphenyl)-1-morpholin-4-yl-5-[4-(trifluoromethyl)phenyl]penta-2,4-dien-1-one |
| PubChem CID | 173398189 |
| Molecular Formula | C24H24F3NO2 |
| Molecular Weight | 415.46 g/mol |
| Exact Mass | 415.18 |
| IUPAC Name | 3-(3,4-dimethylphenyl)-1-morpholin-4-yl-5-[4-(trifluoromethyl)phenyl]penta-2,4-dien-1-one |
| SMILES | Cc1ccc(C(C=Cc2ccc(C(F)(F)F)cc2)=CC(=O)N2CCOCC2)cc1C |
| InChI | InChI=1S/C24H24F3NO2/c1-17-3-7-20(15-18(17)2)21(16-23(29)28-11-13-30-14-12-28)8-4-19-5-9-22(10-6-19)24(25,26)27/h3-10,15-16H,11-14H2,1-2H3 |
| InChIKey | FOQSPQFJAQYGJX-UHFFFAOYSA-N |
| XLogP | 5.28 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 415.46 |
| LogP ≤ 5 | 5.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze 3-(3,4-dimethylphenyl)-1-morpholin-4-yl-5-[4-(trifluoromethyl)phenyl]penta-2,4-dien-1-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(3,4-dimethylphenyl)-1-morpholin-4-yl-5-[4-(trifluoromethyl)phenyl]penta-2,4-dien-1-one?
The IUPAC name of 3-(3,4-dimethylphenyl)-1-morpholin-4-yl-5-[4-(trifluoromethyl)phenyl]penta-2,4-dien-1-one (CID 173398189) is 3-(3,4-dimethylphenyl)-1-morpholin-4-yl-5-[4-(trifluoromethyl)phenyl]penta-2,4-dien-1-one.
What is the SMILES notation for 3-(3,4-dimethylphenyl)-1-morpholin-4-yl-5-[4-(trifluoromethyl)phenyl]penta-2,4-dien-1-one?
The canonical SMILES for 3-(3,4-dimethylphenyl)-1-morpholin-4-yl-5-[4-(trifluoromethyl)phenyl]penta-2,4-dien-1-one is Cc1ccc(C(C=Cc2ccc(C(F)(F)F)cc2)=CC(=O)N2CCOCC2)cc1C.
What is the InChIKey of 3-(3,4-dimethylphenyl)-1-morpholin-4-yl-5-[4-(trifluoromethyl)phenyl]penta-2,4-dien-1-one?
The InChIKey is FOQSPQFJAQYGJX-UHFFFAOYSA-N. The full InChI is InChI=1S/C24H24F3NO2/c1-17-3-7-20(15-18(17)2)21(16-23(29)28-11-13-30-14-12-28)8-4-19-5-9-22(10-6-19)24(25,26)27/h3-10,15-16H,11-14H2,1-2H3.
What are the key properties of 3-(3,4-dimethylphenyl)-1-morpholin-4-yl-5-[4-(trifluoromethyl)phenyl]penta-2,4-dien-1-one?
3-(3,4-dimethylphenyl)-1-morpholin-4-yl-5-[4-(trifluoromethyl)phenyl]penta-2,4-dien-1-one has a molecular weight of 415.46 g/mol, XLogP of 5.28, 4 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(3,4-dimethylphenyl)-1-morpholin-4-yl-5-[4-(trifluoromethyl)phenyl]penta-2,4-dien-1-one is sourced from PubChem (CID 173398189), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).