About 1-ethyl-2H-1,3-benzothiazole;hydroiodide
1-ethyl-2H-1,3-benzothiazole;hydroiodide (PubChem CID 173398536) has the molecular formula C9H12INS
and a molecular weight of 293.17 g/mol. Its IUPAC name is 1-ethyl-2H-1,3-benzothiazole;hydroiodide.
Molecular Properties
| Compound Name | 1-ethyl-2H-1,3-benzothiazole;hydroiodide |
| PubChem CID | 173398536 |
| Molecular Formula | C9H12INS |
| Molecular Weight | 293.17 g/mol |
| Exact Mass | 292.97 |
| IUPAC Name | 1-ethyl-2H-1,3-benzothiazole;hydroiodide |
| SMILES | CCS1=c2ccccc2=NC1.I |
| InChI | InChI=1S/C9H11NS.HI/c1-2-11-7-10-8-5-3-4-6-9(8)11;/h3-6H,2,7H2,1H3;1H |
| InChIKey | LSWUPXZQSQXZHI-UHFFFAOYSA-N |
| XLogP | 2.43 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 293.17 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze 1-ethyl-2H-1,3-benzothiazole;hydroiodide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-ethyl-2H-1,3-benzothiazole;hydroiodide?
The IUPAC name of 1-ethyl-2H-1,3-benzothiazole;hydroiodide (CID 173398536) is 1-ethyl-2H-1,3-benzothiazole;hydroiodide.
What is the SMILES notation for 1-ethyl-2H-1,3-benzothiazole;hydroiodide?
The canonical SMILES for 1-ethyl-2H-1,3-benzothiazole;hydroiodide is CCS1=c2ccccc2=NC1.I.
What is the InChIKey of 1-ethyl-2H-1,3-benzothiazole;hydroiodide?
The InChIKey is LSWUPXZQSQXZHI-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H11NS.HI/c1-2-11-7-10-8-5-3-4-6-9(8)11;/h3-6H,2,7H2,1H3;1H.
What are the key properties of 1-ethyl-2H-1,3-benzothiazole;hydroiodide?
1-ethyl-2H-1,3-benzothiazole;hydroiodide has a molecular weight of 293.17 g/mol, XLogP of 2.43, 1 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1-ethyl-2H-1,3-benzothiazole;hydroiodide is sourced from PubChem (CID 173398536), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).