About 5-(oxan-2-yl)cyclohexa-2,4-dien-1-one
5-(oxan-2-yl)cyclohexa-2,4-dien-1-one (PubChem CID 173398586) has the molecular formula C11H14O2
and a molecular weight of 178.23 g/mol. Its IUPAC name is 5-(oxan-2-yl)cyclohexa-2,4-dien-1-one.
Molecular Properties
| Compound Name | 5-(oxan-2-yl)cyclohexa-2,4-dien-1-one |
| PubChem CID | 173398586 |
| Molecular Formula | C11H14O2 |
| Molecular Weight | 178.23 g/mol |
| Exact Mass | 178.10 |
| IUPAC Name | 5-(oxan-2-yl)cyclohexa-2,4-dien-1-one |
| SMILES | O=C1C=CC=C(C2CCCCO2)C1 |
| InChI | InChI=1S/C11H14O2/c12-10-5-3-4-9(8-10)11-6-1-2-7-13-11/h3-5,11H,1-2,6-8H2 |
| InChIKey | FDVPVUOKKGKRRG-UHFFFAOYSA-N |
| XLogP | 2.01 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 178.23 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 5-(oxan-2-yl)cyclohexa-2,4-dien-1-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-(oxan-2-yl)cyclohexa-2,4-dien-1-one?
The IUPAC name of 5-(oxan-2-yl)cyclohexa-2,4-dien-1-one (CID 173398586) is 5-(oxan-2-yl)cyclohexa-2,4-dien-1-one.
What is the SMILES notation for 5-(oxan-2-yl)cyclohexa-2,4-dien-1-one?
The canonical SMILES for 5-(oxan-2-yl)cyclohexa-2,4-dien-1-one is O=C1C=CC=C(C2CCCCO2)C1.
What is the InChIKey of 5-(oxan-2-yl)cyclohexa-2,4-dien-1-one?
The InChIKey is FDVPVUOKKGKRRG-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H14O2/c12-10-5-3-4-9(8-10)11-6-1-2-7-13-11/h3-5,11H,1-2,6-8H2.
What are the key properties of 5-(oxan-2-yl)cyclohexa-2,4-dien-1-one?
5-(oxan-2-yl)cyclohexa-2,4-dien-1-one has a molecular weight of 178.23 g/mol, XLogP of 2.01, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 5-(oxan-2-yl)cyclohexa-2,4-dien-1-one is sourced from PubChem (CID 173398586), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).