C12H22Os — CID 173399747
1,2,3,4,5,6-hexamethylcyclohexene;osmium (PubChem CID 173399747) has the molecular formula C12H22Os and a molecular weight of 356.54 g/mol. Its IUPAC name is 1,2,3,4,5,6-hexamethylcyclohexene;osmium.
| Compound Name | 1,2,3,4,5,6-hexamethylcyclohexene;osmium |
|---|---|
| PubChem CID | 173399747 |
| Molecular Formula | C12H22Os |
| Molecular Weight | 356.54 g/mol |
| Exact Mass | 358.13 |
| IUPAC Name | 1,2,3,4,5,6-hexamethylcyclohexene;osmium |
| SMILES | CC1=C(C)C(C)C(C)C(C)C1C.[Os] |
| InChI | InChI=1S/C12H22.Os/c1-7-8(2)10(4)12(6)11(5)9(7)3;/h7-10H,1-6H3; |
| InChIKey | DVSMTGBTMWQRCW-UHFFFAOYSA-N |
| XLogP | 3.88 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.54 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|