About 2-(3-decyl-4-methyl-2H-1,3-thiazol-5-yl)ethanol;hydroiodide
2-(3-decyl-4-methyl-2H-1,3-thiazol-5-yl)ethanol;hydroiodide (PubChem CID 173400274) has the molecular formula C16H32INOS
and a molecular weight of 413.41 g/mol. Its IUPAC name is 2-(3-decyl-4-methyl-2H-1,3-thiazol-5-yl)ethanol;hydroiodide.
Molecular Properties
| Compound Name | 2-(3-decyl-4-methyl-2H-1,3-thiazol-5-yl)ethanol;hydroiodide |
| PubChem CID | 173400274 |
| Molecular Formula | C16H32INOS |
| Molecular Weight | 413.41 g/mol |
| Exact Mass | 413.12 |
| IUPAC Name | 2-(3-decyl-4-methyl-2H-1,3-thiazol-5-yl)ethanol;hydroiodide |
| SMILES | CCCCCCCCCCN1CSC(CCO)=C1C.I |
| InChI | InChI=1S/C16H31NOS.HI/c1-3-4-5-6-7-8-9-10-12-17-14-19-16(11-13-18)15(17)2;/h18H,3-14H2,1-2H3;1H |
| InChIKey | KCYAXCRFISNATG-UHFFFAOYSA-N |
| XLogP | 5.37 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 413.41 |
| LogP ≤ 5 | 5.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze 2-(3-decyl-4-methyl-2H-1,3-thiazol-5-yl)ethanol;hydroiodide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(3-decyl-4-methyl-2H-1,3-thiazol-5-yl)ethanol;hydroiodide?
The IUPAC name of 2-(3-decyl-4-methyl-2H-1,3-thiazol-5-yl)ethanol;hydroiodide (CID 173400274) is 2-(3-decyl-4-methyl-2H-1,3-thiazol-5-yl)ethanol;hydroiodide.
What is the SMILES notation for 2-(3-decyl-4-methyl-2H-1,3-thiazol-5-yl)ethanol;hydroiodide?
The canonical SMILES for 2-(3-decyl-4-methyl-2H-1,3-thiazol-5-yl)ethanol;hydroiodide is CCCCCCCCCCN1CSC(CCO)=C1C.I.
What is the InChIKey of 2-(3-decyl-4-methyl-2H-1,3-thiazol-5-yl)ethanol;hydroiodide?
The InChIKey is KCYAXCRFISNATG-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H31NOS.HI/c1-3-4-5-6-7-8-9-10-12-17-14-19-16(11-13-18)15(17)2;/h18H,3-14H2,1-2H3;1H.
What are the key properties of 2-(3-decyl-4-methyl-2H-1,3-thiazol-5-yl)ethanol;hydroiodide?
2-(3-decyl-4-methyl-2H-1,3-thiazol-5-yl)ethanol;hydroiodide has a molecular weight of 413.41 g/mol, XLogP of 5.37, 11 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(3-decyl-4-methyl-2H-1,3-thiazol-5-yl)ethanol;hydroiodide is sourced from PubChem (CID 173400274), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).