C12H16N2O — CID 17340082
N-[(E)-2-phenylethylideneamino]butanamide (PubChem CID 17340082) has the molecular formula C12H16N2O and a molecular weight of 204.27 g/mol. Its IUPAC name is N-[(E)-2-phenylethylideneamino]butanamide.
| Compound Name | N-[(E)-2-phenylethylideneamino]butanamide |
|---|---|
| PubChem CID | 17340082 |
| Molecular Formula | C12H16N2O |
| Molecular Weight | 204.27 g/mol |
| Exact Mass | 204.13 |
| IUPAC Name | N-[(E)-2-phenylethylideneamino]butanamide |
| SMILES | CCCC(=O)N/N=C/Cc1ccccc1 |
| InChI | InChI=1S/C12H16N2O/c1-2-6-12(15)14-13-10-9-11-7-4-3-5-8-11/h3-5,7-8,10H,2,6,9H2,1H3,(H,14,15)/b13-10+ |
| InChIKey | NACOCDOUTRUCOM-JLHYYAGUSA-N |
| XLogP | 2.13 |
| TPSA | 41.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 204.27 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|