C9H15F6NO2Si — CID 173400833
4-[bis(2,2,2-trifluoroethoxy)silyl]pent-4-en-1-amine (PubChem CID 173400833) has the molecular formula C9H15F6NO2Si and a molecular weight of 311.30 g/mol. Its IUPAC name is 4-[bis(2,2,2-trifluoroethoxy)silyl]pent-4-en-1-amine.
| Compound Name | 4-[bis(2,2,2-trifluoroethoxy)silyl]pent-4-en-1-amine |
|---|---|
| PubChem CID | 173400833 |
| Molecular Formula | C9H15F6NO2Si |
| Molecular Weight | 311.30 g/mol |
| Exact Mass | 311.08 |
| IUPAC Name | 4-[bis(2,2,2-trifluoroethoxy)silyl]pent-4-en-1-amine |
| SMILES | C=C(CCCN)[SiH](OCC(F)(F)F)OCC(F)(F)F |
| InChI | InChI=1S/C9H15F6NO2Si/c1-7(3-2-4-16)19(17-5-8(10,11)12)18-6-9(13,14)15/h19H,1-6,16H2 |
| InChIKey | DWIVGWNGQLRQJX-UHFFFAOYSA-N |
| XLogP | 2.20 |
| TPSA | 44.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.30 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|