C8H8Cl2O3Pd — CID 173401083
palladium(2+);4,5,6,7-tetrahydro-2-benzofuran-1,3-dione;dichloride (PubChem CID 173401083) has the molecular formula C8H8Cl2O3Pd and a molecular weight of 329.48 g/mol. Its IUPAC name is palladium(2+);4,5,6,7-tetrahydro-2-benzofuran-1,3-dione;dichloride.
| Compound Name | palladium(2+);4,5,6,7-tetrahydro-2-benzofuran-1,3-dione;dichloride |
|---|---|
| PubChem CID | 173401083 |
| Molecular Formula | C8H8Cl2O3Pd |
| Molecular Weight | 329.48 g/mol |
| Exact Mass | 327.89 |
| IUPAC Name | palladium(2+);4,5,6,7-tetrahydro-2-benzofuran-1,3-dione;dichloride |
| SMILES | O=C1OC(=O)C2=C1CCCC2.[Cl-].[Cl-].[Pd+2] |
| InChI | InChI=1S/C8H8O3.2ClH.Pd/c9-7-5-3-1-2-4-6(5)8(10)11-7;;;/h1-4H2;2*1H;/q;;;+2/p-2 |
| InChIKey | GNZYNYQNMUCXDU-UHFFFAOYSA-L |
| XLogP | -5.05 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.48 |
| LogP ≤ 5 | -5.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|