About methylidyne(2-methylpropyl)azanium;chloride;hydrochloride
methylidyne(2-methylpropyl)azanium;chloride;hydrochloride (PubChem CID 173401173) has the molecular formula C5H11Cl2N
and a molecular weight of 156.06 g/mol. Its IUPAC name is methylidyne(2-methylpropyl)azanium;chloride;hydrochloride.
Molecular Properties
| Compound Name | methylidyne(2-methylpropyl)azanium;chloride;hydrochloride |
| PubChem CID | 173401173 |
| Molecular Formula | C5H11Cl2N |
| Molecular Weight | 156.06 g/mol |
| Exact Mass | 155.03 |
| IUPAC Name | methylidyne(2-methylpropyl)azanium;chloride;hydrochloride |
| SMILES | C#[N+]CC(C)C.Cl.[Cl-] |
| InChI | InChI=1S/C5H10N.2ClH/c1-5(2)4-6-3;;/h3,5H,4H2,1-2H3;2*1H/q+1;;/p-1 |
| InChIKey | DSTUWPZWHHLJFV-UHFFFAOYSA-M |
| XLogP | -0.97 |
| TPSA | 4.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 156.06 |
| LogP ≤ 5 | -0.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze methylidyne(2-methylpropyl)azanium;chloride;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methylidyne(2-methylpropyl)azanium;chloride;hydrochloride?
The IUPAC name of methylidyne(2-methylpropyl)azanium;chloride;hydrochloride (CID 173401173) is methylidyne(2-methylpropyl)azanium;chloride;hydrochloride.
What is the SMILES notation for methylidyne(2-methylpropyl)azanium;chloride;hydrochloride?
The canonical SMILES for methylidyne(2-methylpropyl)azanium;chloride;hydrochloride is C#[N+]CC(C)C.Cl.[Cl-].
What is the InChIKey of methylidyne(2-methylpropyl)azanium;chloride;hydrochloride?
The InChIKey is DSTUWPZWHHLJFV-UHFFFAOYSA-M. The full InChI is InChI=1S/C5H10N.2ClH/c1-5(2)4-6-3;;/h3,5H,4H2,1-2H3;2*1H/q+1;;/p-1.
What are the key properties of methylidyne(2-methylpropyl)azanium;chloride;hydrochloride?
methylidyne(2-methylpropyl)azanium;chloride;hydrochloride has a molecular weight of 156.06 g/mol, XLogP of -0.97, 1 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for methylidyne(2-methylpropyl)azanium;chloride;hydrochloride is sourced from PubChem (CID 173401173), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).