C9H16N2O3 — CID 173401966
2,3,4,6,7,8-hexahydropyrrolo[1,2-a]pyrimidine;methyl hydrogen carbonate (PubChem CID 173401966) has the molecular formula C9H16N2O3 and a molecular weight of 200.24 g/mol. Its IUPAC name is 2,3,4,6,7,8-hexahydropyrrolo[1,2-a]pyrimidine;methyl hydrogen carbonate.
| Compound Name | 2,3,4,6,7,8-hexahydropyrrolo[1,2-a]pyrimidine;methyl hydrogen carbonate |
|---|---|
| PubChem CID | 173401966 |
| Molecular Formula | C9H16N2O3 |
| Molecular Weight | 200.24 g/mol |
| Exact Mass | 200.12 |
| IUPAC Name | 2,3,4,6,7,8-hexahydropyrrolo[1,2-a]pyrimidine;methyl hydrogen carbonate |
| SMILES | C1CN=C2CCCN2C1.COC(=O)O |
| InChI | InChI=1S/C7H12N2.C2H4O3/c1-3-7-8-4-2-6-9(7)5-1;1-5-2(3)4/h1-6H2;1H3,(H,3,4) |
| InChIKey | MFPOUYYKHDGOLI-UHFFFAOYSA-N |
| XLogP | 1.20 |
| TPSA | 62.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 200.24 |
| LogP ≤ 5 | 1.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |