C6H12N4S — CID 173402457
prop-2-enyl N-carbamimidoyl-N-methylcarbamimidothioate (PubChem CID 173402457) has the molecular formula C6H12N4S and a molecular weight of 172.26 g/mol. Its IUPAC name is prop-2-enyl N-carbamimidoyl-N-methylcarbamimidothioate.
| Compound Name | prop-2-enyl N-carbamimidoyl-N-methylcarbamimidothioate |
|---|---|
| PubChem CID | 173402457 |
| Molecular Formula | C6H12N4S |
| Molecular Weight | 172.26 g/mol |
| Exact Mass | 172.08 |
| IUPAC Name | prop-2-enyl N-carbamimidoyl-N-methylcarbamimidothioate |
| SMILES | [H]/N=C(\SCC=C)N(C)/C(N)=N/[H] |
| InChI | InChI=1S/C6H12N4S/c1-3-4-11-6(9)10(2)5(7)8/h3,9H,1,4H2,2H3,(H3,7,8)/b9-6- |
| InChIKey | SNQHSWODRZQKLI-TWGQIWQCSA-N |
| XLogP | 0.67 |
| TPSA | 76.96 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 172.26 |
| LogP ≤ 5 | 0.67 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|