C12H17IN4 — CID 173403073
7-methyl-5,6,6a,10-tetrahydro-1H-pyrido[2,3-h]quinazolin-2-amine;hydroiodide (PubChem CID 173403073) has the molecular formula C12H17IN4 and a molecular weight of 344.20 g/mol. Its IUPAC name is 7-methyl-5,6,6a,10-tetrahydro-1H-pyrido[2,3-h]quinazolin-2-amine;hydroiodide.
| Compound Name | 7-methyl-5,6,6a,10-tetrahydro-1H-pyrido[2,3-h]quinazolin-2-amine;hydroiodide |
|---|---|
| PubChem CID | 173403073 |
| Molecular Formula | C12H17IN4 |
| Molecular Weight | 344.20 g/mol |
| Exact Mass | 344.05 |
| IUPAC Name | 7-methyl-5,6,6a,10-tetrahydro-1H-pyrido[2,3-h]quinazolin-2-amine;hydroiodide |
| SMILES | CN1C=CCC2=C3NC(N)=NC=C3CCC21.I |
| InChI | InChI=1S/C12H16N4.HI/c1-16-6-2-3-9-10(16)5-4-8-7-14-12(13)15-11(8)9;/h2,6-7,10H,3-5H2,1H3,(H3,13,14,15);1H |
| InChIKey | LJJNRIBLONVCPJ-UHFFFAOYSA-N |
| XLogP | 1.67 |
| TPSA | 53.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.20 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|