C13H20N6O6S3 — CID 173403246
N-amino-N'-[4-[2-(methanesulfonamidomethylideneamino)ethylsulfanylmethyl]-1,3-thiazol-2-yl]methanimidamide;but-2-enedioic acid (PubChem CID 173403246) has the molecular formula C13H20N6O6S3 and a molecular weight of 452.54 g/mol. Its IUPAC name is N-amino-N'-[4-[2-(methanesulfonamidomethylideneamino)ethylsulfanylmethyl]-1,3-thiazol-2-yl]methanimidamide;but-2-enedioic acid.
| Compound Name | N-amino-N'-[4-[2-(methanesulfonamidomethylideneamino)ethylsulfanylmethyl]-1,3-thiazol-2-yl]methanimidamide;but-2-enedioic acid |
|---|---|
| PubChem CID | 173403246 |
| Molecular Formula | C13H20N6O6S3 |
| Molecular Weight | 452.54 g/mol |
| Exact Mass | 452.06 |
| IUPAC Name | N-amino-N'-[4-[2-(methanesulfonamidomethylideneamino)ethylsulfanylmethyl]-1,3-thiazol-2-yl]methanimidamide;but-2-enedioic acid |
| SMILES | CS(=O)(=O)N/C=N/CCSCc1csc(N=CNN)n1.O=C(O)C=CC(=O)O |
| InChI | InChI=1S/C9H16N6O2S3.C4H4O4/c1-20(16,17)14-6-11-2-3-18-4-8-5-19-9(15-8)12-7-13-10;5-3(6)1-2-4(7)8/h5-7H,2-4,10H2,1H3,(H,11,14)(H,12,13,15);1-2H,(H,5,6)(H,7,8) |
| InChIKey | PJEWGRRKOUVECO-UHFFFAOYSA-N |
| XLogP | -0.21 |
| TPSA | 196.43 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.54 |
| LogP ≤ 5 | -0.21 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|