C18H24F6N8O6S — CID 173403282
but-2-enedioic acid;2-methyl-1-[4-[4-[[N'-(2,2,2-trifluoroethyl)carbamimidoyl]amino]pyrimidin-2-yl]butyl]-3-(trifluoromethylsulfonyl)guanidine (PubChem CID 173403282) has the molecular formula C18H24F6N8O6S and a molecular weight of 594.50 g/mol. Its IUPAC name is but-2-enedioic acid;2-methyl-1-[4-[4-[[N'-(2,2,2-trifluoroethyl)carbamimidoyl]amino]pyrimidin-2-yl]butyl]-3-(trifluoromethylsulfonyl)guanidine.
| Compound Name | but-2-enedioic acid;2-methyl-1-[4-[4-[[N'-(2,2,2-trifluoroethyl)carbamimidoyl]amino]pyrimidin-2-yl]butyl]-3-(trifluoromethylsulfonyl)guanidine |
|---|---|
| PubChem CID | 173403282 |
| Molecular Formula | C18H24F6N8O6S |
| Molecular Weight | 594.50 g/mol |
| Exact Mass | 594.14 |
| IUPAC Name | but-2-enedioic acid;2-methyl-1-[4-[4-[[N'-(2,2,2-trifluoroethyl)carbamimidoyl]amino]pyrimidin-2-yl]butyl]-3-(trifluoromethylsulfonyl)guanidine |
| SMILES | C/N=C(\NCCCCc1nccc(N/C(N)=N/CC(F)(F)F)n1)NS(=O)(=O)C(F)(F)F.O=C(O)C=CC(=O)O |
| InChI | InChI=1S/C14H20F6N8O2S.C4H4O4/c1-22-12(28-31(29,30)14(18,19)20)24-6-3-2-4-9-23-7-5-10(26-9)27-11(21)25-8-13(15,16)17;5-3(6)1-2-4(7)8/h5,7H,2-4,6,8H2,1H3,(H2,22,24,28)(H3,21,23,25,26,27);1-2H,(H,5,6)(H,7,8) |
| InChIKey | MZLBCQRBMJWGCT-UHFFFAOYSA-N |
| XLogP | 0.81 |
| TPSA | 221.35 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 594.50 |
| LogP ≤ 5 | 0.81 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|