C19H29F4N7O6S3 — CID 173403339
but-2-enedioic acid;2-methyl-1-propylsulfonyl-3-[2-[[2-[[N'-(2,2,3,3-tetrafluoropropyl)carbamimidoyl]amino]-1,3-thiazol-4-yl]methylsulfanyl]ethyl]guanidine (PubChem CID 173403339) has the molecular formula C19H29F4N7O6S3 and a molecular weight of 623.68 g/mol. Its IUPAC name is but-2-enedioic acid;2-methyl-1-propylsulfonyl-3-[2-[[2-[[N'-(2,2,3,3-tetrafluoropropyl)carbamimidoyl]amino]-1,3-thiazol-4-yl]methylsulfanyl]ethyl]guanidine.
| Compound Name | but-2-enedioic acid;2-methyl-1-propylsulfonyl-3-[2-[[2-[[N'-(2,2,3,3-tetrafluoropropyl)carbamimidoyl]amino]-1,3-thiazol-4-yl]methylsulfanyl]ethyl]guanidine |
|---|---|
| PubChem CID | 173403339 |
| Molecular Formula | C19H29F4N7O6S3 |
| Molecular Weight | 623.68 g/mol |
| Exact Mass | 623.13 |
| IUPAC Name | but-2-enedioic acid;2-methyl-1-propylsulfonyl-3-[2-[[2-[[N'-(2,2,3,3-tetrafluoropropyl)carbamimidoyl]amino]-1,3-thiazol-4-yl]methylsulfanyl]ethyl]guanidine |
| SMILES | CCCS(=O)(=O)N/C(=N/C)NCCSCc1csc(N/C(N)=N/CC(F)(F)C(F)F)n1.O=C(O)C=CC(=O)O |
| InChI | InChI=1S/C15H25F4N7O2S3.C4H4O4/c1-3-6-31(27,28)26-13(21-2)22-4-5-29-7-10-8-30-14(24-10)25-12(20)23-9-15(18,19)11(16)17;5-3(6)1-2-4(7)8/h8,11H,3-7,9H2,1-2H3,(H2,21,22,26)(H3,20,23,24,25);1-2H,(H,5,6)(H,7,8) |
| InChIKey | MLIUATQKQKSFBF-UHFFFAOYSA-N |
| XLogP | 1.62 |
| TPSA | 208.46 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 623.68 |
| LogP ≤ 5 | 1.62 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|