C12H19AlN3O6P — CID 173403371
alumane;phosphoric acid;2,3,5-tris(aziridin-1-yl)cyclohexa-2,5-diene-1,4-dione (PubChem CID 173403371) has the molecular formula C12H19AlN3O6P and a molecular weight of 359.26 g/mol. Its IUPAC name is alumane;phosphoric acid;2,3,5-tris(aziridin-1-yl)cyclohexa-2,5-diene-1,4-dione.
| Compound Name | alumane;phosphoric acid;2,3,5-tris(aziridin-1-yl)cyclohexa-2,5-diene-1,4-dione |
|---|---|
| PubChem CID | 173403371 |
| Molecular Formula | C12H19AlN3O6P |
| Molecular Weight | 359.26 g/mol |
| Exact Mass | 359.08 |
| IUPAC Name | alumane;phosphoric acid;2,3,5-tris(aziridin-1-yl)cyclohexa-2,5-diene-1,4-dione |
| SMILES | O=C1C=C(N2CC2)C(=O)C(N2CC2)=C1N1CC1.O=P(O)(O)O.[AlH3] |
| InChI | InChI=1S/C12H13N3O2.Al.H3O4P.3H/c16-9-7-8(13-1-2-13)12(17)11(15-5-6-15)10(9)14-3-4-14;;1-5(2,3)4;;;/h7H,1-6H2;;(H3,1,2,3,4);;; |
| InChIKey | KGOQXZXIFCIVMC-UHFFFAOYSA-N |
| XLogP | -2.93 |
| TPSA | 120.93 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.26 |
| LogP ≤ 5 | -2.93 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'chinone_1', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|