C24H24N4O2 — CID 173403372
1-[(5Z,9Z,15Z)-4-(1-hydroxyethyl)-23,24-dihydro-22H-porphyrin-2-yl]ethanol (PubChem CID 173403372) has the molecular formula C24H24N4O2 and a molecular weight of 400.48 g/mol. Its IUPAC name is 1-[(5Z,9Z,15Z)-4-(1-hydroxyethyl)-23,24-dihydro-22H-porphyrin-2-yl]ethanol.
| Compound Name | 1-[(5Z,9Z,15Z)-4-(1-hydroxyethyl)-23,24-dihydro-22H-porphyrin-2-yl]ethanol |
|---|---|
| PubChem CID | 173403372 |
| Molecular Formula | C24H24N4O2 |
| Molecular Weight | 400.48 g/mol |
| Exact Mass | 400.19 |
| IUPAC Name | 1-[(5Z,9Z,15Z)-4-(1-hydroxyethyl)-23,24-dihydro-22H-porphyrin-2-yl]ethanol |
| SMILES | CC(O)C1=CC2(C(C)O)/C=c3/cc/c([nH]3)=C/c3ccc([nH]3)/C=c3/ccc([nH]3)=CC1=N2 |
| InChI | InChI=1S/C24H24N4O2/c1-14(29)22-13-24(15(2)30)12-21-8-7-19(27-21)10-17-4-3-16(25-17)9-18-5-6-20(26-18)11-23(22)28-24/h3-15,25-27,29-30H,1-2H3/b18-9-,19-10-,20-11?,21-12- |
| InChIKey | KSWYKTAZFCQQSW-HNNLJVQYSA-N |
| XLogP | -0.22 |
| TPSA | 100.19 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.48 |
| LogP ≤ 5 | -0.22 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 3 |