C20H24Cl2IN3O3S — CID 173403423
methyl 5-[3-[[amino(methylsulfanyl)methylidene]amino]propanoyl]-4-(2,3-dichlorophenyl)-2,6-dimethyl-1,4-dihydropyridine-3-carboxylate;hydroiodide (PubChem CID 173403423) has the molecular formula C20H24Cl2IN3O3S and a molecular weight of 584.31 g/mol. Its IUPAC name is methyl 5-[3-[[amino(methylsulfanyl)methylidene]amino]propanoyl]-4-(2,3-dichlorophenyl)-2,6-dimethyl-1,4-dihydropyridine-3-carboxylate;hydroiodide.
| Compound Name | methyl 5-[3-[[amino(methylsulfanyl)methylidene]amino]propanoyl]-4-(2,3-dichlorophenyl)-2,6-dimethyl-1,4-dihydropyridine-3-carboxylate;hydroiodide |
|---|---|
| PubChem CID | 173403423 |
| Molecular Formula | C20H24Cl2IN3O3S |
| Molecular Weight | 584.31 g/mol |
| Exact Mass | 583.00 |
| IUPAC Name | methyl 5-[3-[[amino(methylsulfanyl)methylidene]amino]propanoyl]-4-(2,3-dichlorophenyl)-2,6-dimethyl-1,4-dihydropyridine-3-carboxylate;hydroiodide |
| SMILES | COC(=O)C1=C(C)NC(C)=C(C(=O)CC/N=C(/N)SC)C1c1cccc(Cl)c1Cl.I |
| InChI | InChI=1S/C20H23Cl2N3O3S.HI/c1-10-15(14(26)8-9-24-20(23)29-4)17(12-6-5-7-13(21)18(12)22)16(11(2)25-10)19(27)28-3;/h5-7,17,25H,8-9H2,1-4H3,(H2,23,24);1H |
| InChIKey | QZHCILWBMLLCTM-UHFFFAOYSA-N |
| XLogP | 4.66 |
| TPSA | 93.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 584.31 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|