About potassium;ethyl 2-(3-nitroanilino)-4-oxofuran-3-carboxylate;hydride
potassium;ethyl 2-(3-nitroanilino)-4-oxofuran-3-carboxylate;hydride (PubChem CID 173403446) has the molecular formula C13H13KN2O6
and a molecular weight of 332.35 g/mol. Its IUPAC name is potassium;ethyl 2-(3-nitroanilino)-4-oxofuran-3-carboxylate;hydride.
Molecular Properties
| Compound Name | potassium;ethyl 2-(3-nitroanilino)-4-oxofuran-3-carboxylate;hydride |
| PubChem CID | 173403446 |
| Molecular Formula | C13H13KN2O6 |
| Molecular Weight | 332.35 g/mol |
| Exact Mass | 332.04 |
| IUPAC Name | potassium;ethyl 2-(3-nitroanilino)-4-oxofuran-3-carboxylate;hydride |
| SMILES | CCOC(=O)C1=C(Nc2cccc([N+](=O)[O-])c2)OCC1=O.[H-].[K+] |
| InChI | InChI=1S/C13H12N2O6.K.H/c1-2-20-13(17)11-10(16)7-21-12(11)14-8-4-3-5-9(6-8)15(18)19;;/h3-6,14H,2,7H2,1H3;;/q;+1;-1 |
| InChIKey | SBQOUDLELTVCPM-UHFFFAOYSA-N |
| XLogP | -1.50 |
| TPSA | 107.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 332.35 |
| LogP ≤ 5 | -1.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze potassium;ethyl 2-(3-nitroanilino)-4-oxofuran-3-carboxylate;hydride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of potassium;ethyl 2-(3-nitroanilino)-4-oxofuran-3-carboxylate;hydride?
The IUPAC name of potassium;ethyl 2-(3-nitroanilino)-4-oxofuran-3-carboxylate;hydride (CID 173403446) is potassium;ethyl 2-(3-nitroanilino)-4-oxofuran-3-carboxylate;hydride.
What is the SMILES notation for potassium;ethyl 2-(3-nitroanilino)-4-oxofuran-3-carboxylate;hydride?
The canonical SMILES for potassium;ethyl 2-(3-nitroanilino)-4-oxofuran-3-carboxylate;hydride is CCOC(=O)C1=C(Nc2cccc([N+](=O)[O-])c2)OCC1=O.[H-].[K+].
What is the InChIKey of potassium;ethyl 2-(3-nitroanilino)-4-oxofuran-3-carboxylate;hydride?
The InChIKey is SBQOUDLELTVCPM-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H12N2O6.K.H/c1-2-20-13(17)11-10(16)7-21-12(11)14-8-4-3-5-9(6-8)15(18)19;;/h3-6,14H,2,7H2,1H3;;/q;+1;-1.
What are the key properties of potassium;ethyl 2-(3-nitroanilino)-4-oxofuran-3-carboxylate;hydride?
potassium;ethyl 2-(3-nitroanilino)-4-oxofuran-3-carboxylate;hydride has a molecular weight of 332.35 g/mol, XLogP of -1.50, 5 rotatable bonds, 1 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for potassium;ethyl 2-(3-nitroanilino)-4-oxofuran-3-carboxylate;hydride is sourced from PubChem (CID 173403446), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).