About 10-methoxy-2-methoxycarbonyl-5-methyl-10-oxodec-5-enoic acid;propanedioic acid
10-methoxy-2-methoxycarbonyl-5-methyl-10-oxodec-5-enoic acid;propanedioic acid (PubChem CID 173404404) has the molecular formula C17H26O10
and a molecular weight of 390.39 g/mol. Its IUPAC name is 10-methoxy-2-methoxycarbonyl-5-methyl-10-oxodec-5-enoic acid;propanedioic acid.
Molecular Properties
| Compound Name | 10-methoxy-2-methoxycarbonyl-5-methyl-10-oxodec-5-enoic acid;propanedioic acid |
| PubChem CID | 173404404 |
| Molecular Formula | C17H26O10 |
| Molecular Weight | 390.39 g/mol |
| Exact Mass | 390.15 |
| IUPAC Name | 10-methoxy-2-methoxycarbonyl-5-methyl-10-oxodec-5-enoic acid;propanedioic acid |
| SMILES | COC(=O)CCCC=C(C)CCC(C(=O)O)C(=O)OC.O=C(O)CC(=O)O |
| InChI | InChI=1S/C14H22O6.C3H4O4/c1-10(6-4-5-7-12(15)19-2)8-9-11(13(16)17)14(18)20-3;4-2(5)1-3(6)7/h6,11H,4-5,7-9H2,1-3H3,(H,16,17);1H2,(H,4,5)(H,6,7) |
| InChIKey | PUHAGEOQIMVLED-UHFFFAOYSA-N |
| XLogP | 1.48 |
| TPSA | 164.50 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 390.39 |
| LogP ≤ 5 | 1.48 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 10-methoxy-2-methoxycarbonyl-5-methyl-10-oxodec-5-enoic acid;propanedioic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 10-methoxy-2-methoxycarbonyl-5-methyl-10-oxodec-5-enoic acid;propanedioic acid?
The IUPAC name of 10-methoxy-2-methoxycarbonyl-5-methyl-10-oxodec-5-enoic acid;propanedioic acid (CID 173404404) is 10-methoxy-2-methoxycarbonyl-5-methyl-10-oxodec-5-enoic acid;propanedioic acid.
What is the SMILES notation for 10-methoxy-2-methoxycarbonyl-5-methyl-10-oxodec-5-enoic acid;propanedioic acid?
The canonical SMILES for 10-methoxy-2-methoxycarbonyl-5-methyl-10-oxodec-5-enoic acid;propanedioic acid is COC(=O)CCCC=C(C)CCC(C(=O)O)C(=O)OC.O=C(O)CC(=O)O.
What is the InChIKey of 10-methoxy-2-methoxycarbonyl-5-methyl-10-oxodec-5-enoic acid;propanedioic acid?
The InChIKey is PUHAGEOQIMVLED-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H22O6.C3H4O4/c1-10(6-4-5-7-12(15)19-2)8-9-11(13(16)17)14(18)20-3;4-2(5)1-3(6)7/h6,11H,4-5,7-9H2,1-3H3,(H,16,17);1H2,(H,4,5)(H,6,7).
What are the key properties of 10-methoxy-2-methoxycarbonyl-5-methyl-10-oxodec-5-enoic acid;propanedioic acid?
10-methoxy-2-methoxycarbonyl-5-methyl-10-oxodec-5-enoic acid;propanedioic acid has a molecular weight of 390.39 g/mol, XLogP of 1.48, 11 rotatable bonds, 3 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 10-methoxy-2-methoxycarbonyl-5-methyl-10-oxodec-5-enoic acid;propanedioic acid is sourced from PubChem (CID 173404404), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).