About 9-methyl-4H-pyrido[1,2-a]pyrimidine;hydrochloride
9-methyl-4H-pyrido[1,2-a]pyrimidine;hydrochloride (PubChem CID 173405474) has the molecular formula C9H11ClN2
and a molecular weight of 182.65 g/mol. Its IUPAC name is 9-methyl-4H-pyrido[1,2-a]pyrimidine;hydrochloride.
Molecular Properties
| Compound Name | 9-methyl-4H-pyrido[1,2-a]pyrimidine;hydrochloride |
| PubChem CID | 173405474 |
| Molecular Formula | C9H11ClN2 |
| Molecular Weight | 182.65 g/mol |
| Exact Mass | 182.06 |
| IUPAC Name | 9-methyl-4H-pyrido[1,2-a]pyrimidine;hydrochloride |
| SMILES | CC1=CC=CN2CC=CN=C12.Cl |
| InChI | InChI=1S/C9H10N2.ClH/c1-8-4-2-6-11-7-3-5-10-9(8)11;/h2-6H,7H2,1H3;1H |
| InChIKey | DWHSCTLTUATTDJ-UHFFFAOYSA-N |
| XLogP | 2.11 |
| TPSA | 15.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 182.65 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 9-methyl-4H-pyrido[1,2-a]pyrimidine;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 9-methyl-4H-pyrido[1,2-a]pyrimidine;hydrochloride?
The IUPAC name of 9-methyl-4H-pyrido[1,2-a]pyrimidine;hydrochloride (CID 173405474) is 9-methyl-4H-pyrido[1,2-a]pyrimidine;hydrochloride.
What is the SMILES notation for 9-methyl-4H-pyrido[1,2-a]pyrimidine;hydrochloride?
The canonical SMILES for 9-methyl-4H-pyrido[1,2-a]pyrimidine;hydrochloride is CC1=CC=CN2CC=CN=C12.Cl.
What is the InChIKey of 9-methyl-4H-pyrido[1,2-a]pyrimidine;hydrochloride?
The InChIKey is DWHSCTLTUATTDJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H10N2.ClH/c1-8-4-2-6-11-7-3-5-10-9(8)11;/h2-6H,7H2,1H3;1H.
What are the key properties of 9-methyl-4H-pyrido[1,2-a]pyrimidine;hydrochloride?
9-methyl-4H-pyrido[1,2-a]pyrimidine;hydrochloride has a molecular weight of 182.65 g/mol, XLogP of 2.11, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 9-methyl-4H-pyrido[1,2-a]pyrimidine;hydrochloride is sourced from PubChem (CID 173405474), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).