C22H18ClF6NO3 — CID 173405862
(1R)-3-(2-chloro-3,3,3-trifluoroprop-1-enyl)-2,2-dimethyl-1-[(1S)-2,2,2-trifluoro-1-(6-phenoxy-2-pyridinyl)ethyl]cyclopropane-1-carboxylic acid (PubChem CID 173405862) has the molecular formula C22H18ClF6NO3 and a molecular weight of 493.83 g/mol. Its IUPAC name is (1R)-3-(2-chloro-3,3,3-trifluoroprop-1-enyl)-2,2-dimethyl-1-[(1S)-2,2,2-trifluoro-1-(6-phenoxy-2-pyridinyl)ethyl]cyclopropane-1-carboxylic acid.
| Compound Name | (1R)-3-(2-chloro-3,3,3-trifluoroprop-1-enyl)-2,2-dimethyl-1-[(1S)-2,2,2-trifluoro-1-(6-phenoxy-2-pyridinyl)ethyl]cyclopropane-1-carboxylic acid |
|---|---|
| PubChem CID | 173405862 |
| Molecular Formula | C22H18ClF6NO3 |
| Molecular Weight | 493.83 g/mol |
| Exact Mass | 493.09 |
| IUPAC Name | (1R)-3-(2-chloro-3,3,3-trifluoroprop-1-enyl)-2,2-dimethyl-1-[(1S)-2,2,2-trifluoro-1-(6-phenoxy-2-pyridinyl)ethyl]cyclopropane-1-carboxylic acid |
| SMILES | CC1(C)C(C=C(Cl)C(F)(F)F)[C@@]1(C(=O)O)[C@@H](c1cccc(Oc2ccccc2)n1)C(F)(F)F |
| InChI | InChI=1S/C22H18ClF6NO3/c1-19(2)14(11-15(23)21(24,25)26)20(19,18(31)32)17(22(27,28)29)13-9-6-10-16(30-13)33-12-7-4-3-5-8-12/h3-11,14,17H,1-2H3,(H,31,32)/t14?,17-,20+/m1/s1 |
| InChIKey | TZUPJRPFILVSAE-SBCCGAISSA-N |
| XLogP | 6.93 |
| TPSA | 59.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.83 |
| LogP ≤ 5 | 6.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |