C29H48O3 — CID 173406084
1,3,6-trimethyl-4-[(7R,11R)-3,7,11,15-tetramethylhexadec-2-enyl]-7-oxabicyclo[4.1.0]hept-3-ene-2,5-dione (PubChem CID 173406084) has the molecular formula C29H48O3 and a molecular weight of 444.70 g/mol. Its IUPAC name is 1,3,6-trimethyl-4-[(7R,11R)-3,7,11,15-tetramethylhexadec-2-enyl]-7-oxabicyclo[4.1.0]hept-3-ene-2,5-dione.
| Compound Name | 1,3,6-trimethyl-4-[(7R,11R)-3,7,11,15-tetramethylhexadec-2-enyl]-7-oxabicyclo[4.1.0]hept-3-ene-2,5-dione |
|---|---|
| PubChem CID | 173406084 |
| Molecular Formula | C29H48O3 |
| Molecular Weight | 444.70 g/mol |
| Exact Mass | 444.36 |
| IUPAC Name | 1,3,6-trimethyl-4-[(7R,11R)-3,7,11,15-tetramethylhexadec-2-enyl]-7-oxabicyclo[4.1.0]hept-3-ene-2,5-dione |
| SMILES | CC(=CCC1=C(C)C(=O)C2(C)OC2(C)C1=O)CCC[C@H](C)CCC[C@H](C)CCCC(C)C |
| InChI | InChI=1S/C29H48O3/c1-20(2)12-9-13-21(3)14-10-15-22(4)16-11-17-23(5)18-19-25-24(6)26(30)28(7)29(8,32-28)27(25)31/h18,20-22H,9-17,19H2,1-8H3/t21-,22-,28?,29?/m1/s1 |
| InChIKey | GUVBQVCFJXQBLJ-RGHCOQMCSA-N |
| XLogP | 7.78 |
| TPSA | 46.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.70 |
| LogP ≤ 5 | 7.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|