About potassium;hydride;2-[2-(4-methoxyphenoxy)ethoxy]acetaldehyde
potassium;hydride;2-[2-(4-methoxyphenoxy)ethoxy]acetaldehyde (PubChem CID 173406321) has the molecular formula C11H15KO4
and a molecular weight of 250.34 g/mol. Its IUPAC name is potassium;hydride;2-[2-(4-methoxyphenoxy)ethoxy]acetaldehyde.
Molecular Properties
| Compound Name | potassium;hydride;2-[2-(4-methoxyphenoxy)ethoxy]acetaldehyde |
| PubChem CID | 173406321 |
| Molecular Formula | C11H15KO4 |
| Molecular Weight | 250.34 g/mol |
| Exact Mass | 250.06 |
| IUPAC Name | potassium;hydride;2-[2-(4-methoxyphenoxy)ethoxy]acetaldehyde |
| SMILES | COc1ccc(OCCOCC=O)cc1.[H-].[K+] |
| InChI | InChI=1S/C11H14O4.K.H/c1-13-10-2-4-11(5-3-10)15-9-8-14-7-6-12;;/h2-6H,7-9H2,1H3;;/q;+1;-1 |
| InChIKey | IXSGIUZHYQPRFI-UHFFFAOYSA-N |
| XLogP | -1.59 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 250.34 |
| LogP ≤ 5 | -1.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze potassium;hydride;2-[2-(4-methoxyphenoxy)ethoxy]acetaldehyde with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of potassium;hydride;2-[2-(4-methoxyphenoxy)ethoxy]acetaldehyde?
The IUPAC name of potassium;hydride;2-[2-(4-methoxyphenoxy)ethoxy]acetaldehyde (CID 173406321) is potassium;hydride;2-[2-(4-methoxyphenoxy)ethoxy]acetaldehyde.
What is the SMILES notation for potassium;hydride;2-[2-(4-methoxyphenoxy)ethoxy]acetaldehyde?
The canonical SMILES for potassium;hydride;2-[2-(4-methoxyphenoxy)ethoxy]acetaldehyde is COc1ccc(OCCOCC=O)cc1.[H-].[K+].
What is the InChIKey of potassium;hydride;2-[2-(4-methoxyphenoxy)ethoxy]acetaldehyde?
The InChIKey is IXSGIUZHYQPRFI-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H14O4.K.H/c1-13-10-2-4-11(5-3-10)15-9-8-14-7-6-12;;/h2-6H,7-9H2,1H3;;/q;+1;-1.
What are the key properties of potassium;hydride;2-[2-(4-methoxyphenoxy)ethoxy]acetaldehyde?
potassium;hydride;2-[2-(4-methoxyphenoxy)ethoxy]acetaldehyde has a molecular weight of 250.34 g/mol, XLogP of -1.59, 7 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for potassium;hydride;2-[2-(4-methoxyphenoxy)ethoxy]acetaldehyde is sourced from PubChem (CID 173406321), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).