C15H18BrN3O4 — CID 173406667
2-[[3-bromo-4-[(4,4-dimethyl-3-oxo-1,2-oxazolidin-2-yl)methyl]phenyl]hydrazinylidene]propanoic acid (PubChem CID 173406667) has the molecular formula C15H18BrN3O4 and a molecular weight of 384.23 g/mol. Its IUPAC name is 2-[[3-bromo-4-[(4,4-dimethyl-3-oxo-1,2-oxazolidin-2-yl)methyl]phenyl]hydrazinylidene]propanoic acid.
| Compound Name | 2-[[3-bromo-4-[(4,4-dimethyl-3-oxo-1,2-oxazolidin-2-yl)methyl]phenyl]hydrazinylidene]propanoic acid |
|---|---|
| PubChem CID | 173406667 |
| Molecular Formula | C15H18BrN3O4 |
| Molecular Weight | 384.23 g/mol |
| Exact Mass | 383.05 |
| IUPAC Name | 2-[[3-bromo-4-[(4,4-dimethyl-3-oxo-1,2-oxazolidin-2-yl)methyl]phenyl]hydrazinylidene]propanoic acid |
| SMILES | CC(=NNc1ccc(CN2OCC(C)(C)C2=O)c(Br)c1)C(=O)O |
| InChI | InChI=1S/C15H18BrN3O4/c1-9(13(20)21)17-18-11-5-4-10(12(16)6-11)7-19-14(22)15(2,3)8-23-19/h4-6,18H,7-8H2,1-3H3,(H,20,21) |
| InChIKey | GPZPSFBJRASEDF-UHFFFAOYSA-N |
| XLogP | 2.62 |
| TPSA | 91.23 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.23 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|