C15H29NO2S2 — CID 173406749
1,6-disulfinylhexane;2,2,6,6-tetramethylpiperidine (PubChem CID 173406749) has the molecular formula C15H29NO2S2 and a molecular weight of 319.54 g/mol. Its IUPAC name is 1,6-disulfinylhexane;2,2,6,6-tetramethylpiperidine.
| Compound Name | 1,6-disulfinylhexane;2,2,6,6-tetramethylpiperidine |
|---|---|
| PubChem CID | 173406749 |
| Molecular Formula | C15H29NO2S2 |
| Molecular Weight | 319.54 g/mol |
| Exact Mass | 319.16 |
| IUPAC Name | 1,6-disulfinylhexane;2,2,6,6-tetramethylpiperidine |
| SMILES | CC1(C)CCCC(C)(C)N1.O=S=CCCCCC=S=O |
| InChI | InChI=1S/C9H19N.C6H10O2S2/c1-8(2)6-5-7-9(3,4)10-8;7-9-5-3-1-2-4-6-10-8/h10H,5-7H2,1-4H3;5-6H,1-4H2 |
| InChIKey | LFKQZWBANREJHQ-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.54 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'thio_aldehyd_A(3)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|