C32H50F6N8 — CID 173406773
5,6,7,8,14,15-hexafluoro-2,11,20,29,37,38,39,40-octazanonacyclo[28.6.1.13,10.112,19.121,28.04,9.013,18.022,27.031,36]tetracontane (PubChem CID 173406773) has the molecular formula C32H50F6N8 and a molecular weight of 660.80 g/mol. Its IUPAC name is 5,6,7,8,14,15-hexafluoro-2,11,20,29,37,38,39,40-octazanonacyclo[28.6.1.13,10.112,19.121,28.04,9.013,18.022,27.031,36]tetracontane.
| Compound Name | 5,6,7,8,14,15-hexafluoro-2,11,20,29,37,38,39,40-octazanonacyclo[28.6.1.13,10.112,19.121,28.04,9.013,18.022,27.031,36]tetracontane |
|---|---|
| PubChem CID | 173406773 |
| Molecular Formula | C32H50F6N8 |
| Molecular Weight | 660.80 g/mol |
| Exact Mass | 660.41 |
| IUPAC Name | 5,6,7,8,14,15-hexafluoro-2,11,20,29,37,38,39,40-octazanonacyclo[28.6.1.13,10.112,19.121,28.04,9.013,18.022,27.031,36]tetracontane |
| SMILES | FC1CCC2C3NC4NC(NC5NC(NC6NC(NC(N3)C2C1F)C1C(F)C(F)C(F)C(F)C61)C1CCCCC51)C1CCCCC41 |
| InChI | InChI=1S/C32H50F6N8/c33-16-10-9-15-17(20(16)34)30-44-29(15)42-27-12-6-2-1-5-11(12)25(40-27)39-26-13-7-3-4-8-14(13)28(41-26)43-31-18-19(32(45-30)46-31)22(36)24(38)23(37)21(18)35/h11-32,39-46H,1-10H2 |
| InChIKey | DJVRVDXMJPFWLX-UHFFFAOYSA-N |
| XLogP | 2.29 |
| TPSA | 96.24 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 660.80 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 8 |