C8H12OS — CID 173407241
2,3,5,7,8,8a-hexahydrothiopyrano[4,3-b]pyran (PubChem CID 173407241) has the molecular formula C8H12OS and a molecular weight of 156.25 g/mol. Its IUPAC name is 2,3,5,7,8,8a-hexahydrothiopyrano[4,3-b]pyran.
| Compound Name | 2,3,5,7,8,8a-hexahydrothiopyrano[4,3-b]pyran |
|---|---|
| PubChem CID | 173407241 |
| Molecular Formula | C8H12OS |
| Molecular Weight | 156.25 g/mol |
| Exact Mass | 156.06 |
| IUPAC Name | 2,3,5,7,8,8a-hexahydrothiopyrano[4,3-b]pyran |
| SMILES | C1=C2CSCCC2OCC1 |
| InChI | InChI=1S/C8H12OS/c1-2-7-6-10-5-3-8(7)9-4-1/h2,8H,1,3-6H2 |
| InChIKey | BKKSFLKQZSECHT-UHFFFAOYSA-N |
| XLogP | 1.84 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 156.25 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|