C17H22N2O4S — CID 173407405
3-[2-(4,5-dimethoxy-3-methyl-6-sulfinylcyclohexa-2,4-dien-1-yl)prop-1-enyl]-4-methyl-4,5-dihydro-1H-pyridazin-6-one (PubChem CID 173407405) has the molecular formula C17H22N2O4S and a molecular weight of 350.44 g/mol. Its IUPAC name is 3-[2-(4,5-dimethoxy-3-methyl-6-sulfinylcyclohexa-2,4-dien-1-yl)prop-1-enyl]-4-methyl-4,5-dihydro-1H-pyridazin-6-one.
| Compound Name | 3-[2-(4,5-dimethoxy-3-methyl-6-sulfinylcyclohexa-2,4-dien-1-yl)prop-1-enyl]-4-methyl-4,5-dihydro-1H-pyridazin-6-one |
|---|---|
| PubChem CID | 173407405 |
| Molecular Formula | C17H22N2O4S |
| Molecular Weight | 350.44 g/mol |
| Exact Mass | 350.13 |
| IUPAC Name | 3-[2-(4,5-dimethoxy-3-methyl-6-sulfinylcyclohexa-2,4-dien-1-yl)prop-1-enyl]-4-methyl-4,5-dihydro-1H-pyridazin-6-one |
| SMILES | COC1=C(OC)C(=S=O)C(C(C)=CC2=NNC(=O)CC2C)C=C1C |
| InChI | InChI=1S/C17H22N2O4S/c1-9(7-13-10(2)8-14(20)19-18-13)12-6-11(3)15(22-4)16(23-5)17(12)24-21/h6-7,10,12H,8H2,1-5H3,(H,19,20) |
| InChIKey | NUARJXOKVMBSDG-UHFFFAOYSA-N |
| XLogP | 1.91 |
| TPSA | 76.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.44 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'thio_ketone(43)', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|