C16H20N2O4S — CID 173407552
3-[1-(5-methoxy-4-methyl-6-sulfonylcyclohexa-2,4-dien-1-yl)prop-1-en-2-yl]-4-methyl-4,5-dihydro-1H-pyridazin-6-one (PubChem CID 173407552) has the molecular formula C16H20N2O4S and a molecular weight of 336.41 g/mol. Its IUPAC name is 3-[1-(5-methoxy-4-methyl-6-sulfonylcyclohexa-2,4-dien-1-yl)prop-1-en-2-yl]-4-methyl-4,5-dihydro-1H-pyridazin-6-one.
| Compound Name | 3-[1-(5-methoxy-4-methyl-6-sulfonylcyclohexa-2,4-dien-1-yl)prop-1-en-2-yl]-4-methyl-4,5-dihydro-1H-pyridazin-6-one |
|---|---|
| PubChem CID | 173407552 |
| Molecular Formula | C16H20N2O4S |
| Molecular Weight | 336.41 g/mol |
| Exact Mass | 336.11 |
| IUPAC Name | 3-[1-(5-methoxy-4-methyl-6-sulfonylcyclohexa-2,4-dien-1-yl)prop-1-en-2-yl]-4-methyl-4,5-dihydro-1H-pyridazin-6-one |
| SMILES | COC1=C(C)C=CC(C=C(C)C2=NNC(=O)CC2C)C1=S(=O)=O |
| InChI | InChI=1S/C16H20N2O4S/c1-9-5-6-12(16(23(20)21)15(9)22-4)7-10(2)14-11(3)8-13(19)17-18-14/h5-7,11-12H,8H2,1-4H3,(H,17,19) |
| InChIKey | QEHAHJXUPGFFIS-UHFFFAOYSA-N |
| XLogP | 1.60 |
| TPSA | 84.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.41 |
| LogP ≤ 5 | 1.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'thio_ketone(43)', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|