C18H20N2O4S — CID 173407624
3-[1-(5-methoxy-4-prop-2-ynyl-6-sulfonylcyclohexa-2,4-dien-1-yl)prop-1-en-2-yl]-4-methyl-4,5-dihydro-1H-pyridazin-6-one (PubChem CID 173407624) has the molecular formula C18H20N2O4S and a molecular weight of 360.44 g/mol. Its IUPAC name is 3-[1-(5-methoxy-4-prop-2-ynyl-6-sulfonylcyclohexa-2,4-dien-1-yl)prop-1-en-2-yl]-4-methyl-4,5-dihydro-1H-pyridazin-6-one.
| Compound Name | 3-[1-(5-methoxy-4-prop-2-ynyl-6-sulfonylcyclohexa-2,4-dien-1-yl)prop-1-en-2-yl]-4-methyl-4,5-dihydro-1H-pyridazin-6-one |
|---|---|
| PubChem CID | 173407624 |
| Molecular Formula | C18H20N2O4S |
| Molecular Weight | 360.44 g/mol |
| Exact Mass | 360.11 |
| IUPAC Name | 3-[1-(5-methoxy-4-prop-2-ynyl-6-sulfonylcyclohexa-2,4-dien-1-yl)prop-1-en-2-yl]-4-methyl-4,5-dihydro-1H-pyridazin-6-one |
| SMILES | C#CCC1=C(OC)C(=S(=O)=O)C(C=C(C)C2=NNC(=O)CC2C)C=C1 |
| InChI | InChI=1S/C18H20N2O4S/c1-5-6-13-7-8-14(18(25(22)23)17(13)24-4)9-11(2)16-12(3)10-15(21)19-20-16/h1,7-9,12,14H,6,10H2,2-4H3,(H,19,21) |
| InChIKey | LYQXSNSWLZWXQU-UHFFFAOYSA-N |
| XLogP | 1.61 |
| TPSA | 84.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.44 |
| LogP ≤ 5 | 1.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'thio_ketone(43)', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|