About 2-[(2-sulfanylidene-3H-1,3,4-thiadiazol-5-yl)sulfanyl]ethylphosphonic acid
2-[(2-sulfanylidene-3H-1,3,4-thiadiazol-5-yl)sulfanyl]ethylphosphonic acid (PubChem CID 173407760) has the molecular formula C4H7N2O3PS3
and a molecular weight of 258.29 g/mol. Its IUPAC name is 2-[(2-sulfanylidene-3H-1,3,4-thiadiazol-5-yl)sulfanyl]ethylphosphonic acid.
Molecular Properties
| Compound Name | 2-[(2-sulfanylidene-3H-1,3,4-thiadiazol-5-yl)sulfanyl]ethylphosphonic acid |
| PubChem CID | 173407760 |
| Molecular Formula | C4H7N2O3PS3 |
| Molecular Weight | 258.29 g/mol |
| Exact Mass | 257.94 |
| IUPAC Name | 2-[(2-sulfanylidene-3H-1,3,4-thiadiazol-5-yl)sulfanyl]ethylphosphonic acid |
| SMILES | O=P(O)(O)CCSc1n[nH]c(=S)s1 |
| InChI | InChI=1S/C4H7N2O3PS3/c7-10(8,9)1-2-12-4-6-5-3(11)13-4/h1-2H2,(H,5,11)(H2,7,8,9) |
| InChIKey | AMTWXXQQVASOOK-UHFFFAOYSA-N |
| XLogP | 1.47 |
| TPSA | 86.21 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 258.29 |
| LogP ≤ 5 | 1.47 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze 2-[(2-sulfanylidene-3H-1,3,4-thiadiazol-5-yl)sulfanyl]ethylphosphonic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[(2-sulfanylidene-3H-1,3,4-thiadiazol-5-yl)sulfanyl]ethylphosphonic acid?
The IUPAC name of 2-[(2-sulfanylidene-3H-1,3,4-thiadiazol-5-yl)sulfanyl]ethylphosphonic acid (CID 173407760) is 2-[(2-sulfanylidene-3H-1,3,4-thiadiazol-5-yl)sulfanyl]ethylphosphonic acid.
What is the SMILES notation for 2-[(2-sulfanylidene-3H-1,3,4-thiadiazol-5-yl)sulfanyl]ethylphosphonic acid?
The canonical SMILES for 2-[(2-sulfanylidene-3H-1,3,4-thiadiazol-5-yl)sulfanyl]ethylphosphonic acid is O=P(O)(O)CCSc1n[nH]c(=S)s1.
What is the InChIKey of 2-[(2-sulfanylidene-3H-1,3,4-thiadiazol-5-yl)sulfanyl]ethylphosphonic acid?
The InChIKey is AMTWXXQQVASOOK-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H7N2O3PS3/c7-10(8,9)1-2-12-4-6-5-3(11)13-4/h1-2H2,(H,5,11)(H2,7,8,9).
What are the key properties of 2-[(2-sulfanylidene-3H-1,3,4-thiadiazol-5-yl)sulfanyl]ethylphosphonic acid?
2-[(2-sulfanylidene-3H-1,3,4-thiadiazol-5-yl)sulfanyl]ethylphosphonic acid has a molecular weight of 258.29 g/mol, XLogP of 1.47, 4 rotatable bonds, 3 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[(2-sulfanylidene-3H-1,3,4-thiadiazol-5-yl)sulfanyl]ethylphosphonic acid is sourced from PubChem (CID 173407760), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).