About 1-methylsulfanyl-2-nitro-N'-prop-2-ynylethene-1,2-diamine
1-methylsulfanyl-2-nitro-N'-prop-2-ynylethene-1,2-diamine (PubChem CID 173408988) has the molecular formula C6H9N3O2S
and a molecular weight of 187.22 g/mol. Its IUPAC name is 1-methylsulfanyl-2-nitro-N'-prop-2-ynylethene-1,2-diamine.
Molecular Properties
| Compound Name | 1-methylsulfanyl-2-nitro-N'-prop-2-ynylethene-1,2-diamine |
| PubChem CID | 173408988 |
| Molecular Formula | C6H9N3O2S |
| Molecular Weight | 187.22 g/mol |
| Exact Mass | 187.04 |
| IUPAC Name | 1-methylsulfanyl-2-nitro-N'-prop-2-ynylethene-1,2-diamine |
| SMILES | C#CCNC(=C(N)SC)[N+](=O)[O-] |
| InChI | InChI=1S/C6H9N3O2S/c1-3-4-8-6(9(10)11)5(7)12-2/h1,8H,4,7H2,2H3 |
| InChIKey | VYJATHBMXLLAEJ-UHFFFAOYSA-N |
| XLogP | -0.07 |
| TPSA | 81.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 187.22 |
| LogP ≤ 5 | -0.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze 1-methylsulfanyl-2-nitro-N'-prop-2-ynylethene-1,2-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-methylsulfanyl-2-nitro-N'-prop-2-ynylethene-1,2-diamine?
The IUPAC name of 1-methylsulfanyl-2-nitro-N'-prop-2-ynylethene-1,2-diamine (CID 173408988) is 1-methylsulfanyl-2-nitro-N'-prop-2-ynylethene-1,2-diamine.
What is the SMILES notation for 1-methylsulfanyl-2-nitro-N'-prop-2-ynylethene-1,2-diamine?
The canonical SMILES for 1-methylsulfanyl-2-nitro-N'-prop-2-ynylethene-1,2-diamine is C#CCNC(=C(N)SC)[N+](=O)[O-].
What is the InChIKey of 1-methylsulfanyl-2-nitro-N'-prop-2-ynylethene-1,2-diamine?
The InChIKey is VYJATHBMXLLAEJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H9N3O2S/c1-3-4-8-6(9(10)11)5(7)12-2/h1,8H,4,7H2,2H3.
What are the key properties of 1-methylsulfanyl-2-nitro-N'-prop-2-ynylethene-1,2-diamine?
1-methylsulfanyl-2-nitro-N'-prop-2-ynylethene-1,2-diamine has a molecular weight of 187.22 g/mol, XLogP of -0.07, 4 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 1-methylsulfanyl-2-nitro-N'-prop-2-ynylethene-1,2-diamine is sourced from PubChem (CID 173408988), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).