C14H20O — CID 173409519
1-(2-phenylpropyl)cyclopentan-1-ol (PubChem CID 173409519) has the molecular formula C14H20O and a molecular weight of 204.31 g/mol. Its IUPAC name is 1-(2-phenylpropyl)cyclopentan-1-ol.
| Compound Name | 1-(2-phenylpropyl)cyclopentan-1-ol |
|---|---|
| PubChem CID | 173409519 |
| Molecular Formula | C14H20O |
| Molecular Weight | 204.31 g/mol |
| Exact Mass | 204.15 |
| IUPAC Name | 1-(2-phenylpropyl)cyclopentan-1-ol |
| SMILES | CC(CC1(O)CCCC1)c1ccccc1 |
| InChI | InChI=1S/C14H20O/c1-12(13-7-3-2-4-8-13)11-14(15)9-5-6-10-14/h2-4,7-8,12,15H,5-6,9-11H2,1H3 |
| InChIKey | VKJXPEIYSXLXRT-UHFFFAOYSA-N |
| XLogP | 3.49 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 204.31 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |