C19H29NO3SSi — CID 173410282
S-phenyl 2-[(2R,3S)-3-[(2R)-2-dimethylsilyloxy-3,3-dimethylbutan-2-yl]-4-oxoazetidin-2-yl]ethanethioate (PubChem CID 173410282) has the molecular formula C19H29NO3SSi and a molecular weight of 379.60 g/mol. Its IUPAC name is S-phenyl 2-[(2R,3S)-3-[(2R)-2-dimethylsilyloxy-3,3-dimethylbutan-2-yl]-4-oxoazetidin-2-yl]ethanethioate.
| Compound Name | S-phenyl 2-[(2R,3S)-3-[(2R)-2-dimethylsilyloxy-3,3-dimethylbutan-2-yl]-4-oxoazetidin-2-yl]ethanethioate |
|---|---|
| PubChem CID | 173410282 |
| Molecular Formula | C19H29NO3SSi |
| Molecular Weight | 379.60 g/mol |
| Exact Mass | 379.16 |
| IUPAC Name | S-phenyl 2-[(2R,3S)-3-[(2R)-2-dimethylsilyloxy-3,3-dimethylbutan-2-yl]-4-oxoazetidin-2-yl]ethanethioate |
| SMILES | C[SiH](C)O[C@](C)([C@H]1C(=O)N[C@@H]1CC(=O)Sc1ccccc1)C(C)(C)C |
| InChI | InChI=1S/C19H29NO3SSi/c1-18(2,3)19(4,23-25(5)6)16-14(20-17(16)22)12-15(21)24-13-10-8-7-9-11-13/h7-11,14,16,25H,12H2,1-6H3,(H,20,22)/t14-,16-,19-/m1/s1 |
| InChIKey | VOXGQYZZKYFQFH-IDHHARJASA-N |
| XLogP | 3.61 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.60 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|